C12H16ClFN2O — CID 107528482
2-(aminomethyl)-N-(2-chloro-5-fluorophenyl)pentanamide (PubChem CID 107528482) has the molecular formula C12H16ClFN2O and a molecular weight of 258.72 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-chloro-5-fluorophenyl)pentanamide.
| Compound Name | 2-(aminomethyl)-N-(2-chloro-5-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 107528482 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(aminomethyl)-N-(2-chloro-5-fluorophenyl)pentanamide |
| SMILES | CCCC(CN)C(=O)Nc1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H16ClFN2O/c1-2-3-8(7-15)12(17)16-11-6-9(14)4-5-10(11)13/h4-6,8H,2-3,7,15H2,1H3,(H,16,17) |
| InChIKey | PAHQFIUZQRNXFF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |