C13H22N2O — CID 107529578
5-[(2,2-dicyclopropylethylamino)methyl]pyrrolidin-2-one (PubChem CID 107529578) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-[(2,2-dicyclopropylethylamino)methyl]pyrrolidin-2-one.
| Compound Name | 5-[(2,2-dicyclopropylethylamino)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 107529578 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 5-[(2,2-dicyclopropylethylamino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CNCC(C2CC2)C2CC2)N1 |
| InChI | InChI=1S/C13H22N2O/c16-13-6-5-11(15-13)7-14-8-12(9-1-2-9)10-3-4-10/h9-12,14H,1-8H2,(H,15,16) |
| InChIKey | AIEPEEUPNQNKLK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |