About 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one
5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one (PubChem CID 107530457) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one |
| PubChem CID | 107530457 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one |
| SMILES | Nc1cccc2c1CCN(CC1CCC(=O)N1)C2 |
| InChI | InChI=1S/C14H19N3O/c15-13-3-1-2-10-8-17(7-6-12(10)13)9-11-4-5-14(18)16-11/h1-3,11H,4-9,15H2,(H,16,18) |
| InChIKey | CFHVSKDRGPEPMY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one?
The IUPAC name of 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one (CID 107530457) is 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one?
The canonical SMILES for 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one is Nc1cccc2c1CCN(CC1CCC(=O)N1)C2.
What is the InChIKey of 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one?
The InChIKey is CFHVSKDRGPEPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c15-13-3-1-2-10-8-17(7-6-12(10)13)9-11-4-5-14(18)16-11/h1-3,11H,4-9,15H2,(H,16,18).
What are the key properties of 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one?
5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one has a molecular weight of 245.33 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-amino-3,4-dihydro-1H-isoquinolin-2-yl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 107530457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).