C12H21N5O — CID 107530869
5-[[4-[(2-methylpropylamino)methyl]triazol-1-yl]methyl]pyrrolidin-2-one (PubChem CID 107530869) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-[[4-[(2-methylpropylamino)methyl]triazol-1-yl]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[4-[(2-methylpropylamino)methyl]triazol-1-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 107530869 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 5-[[4-[(2-methylpropylamino)methyl]triazol-1-yl]methyl]pyrrolidin-2-one |
| SMILES | CC(C)CNCc1cn(CC2CCC(=O)N2)nn1 |
| InChI | InChI=1S/C12H21N5O/c1-9(2)5-13-6-11-8-17(16-15-11)7-10-3-4-12(18)14-10/h8-10,13H,3-7H2,1-2H3,(H,14,18) |
| InChIKey | YXWIDIILOBQSEY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |