About 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene
10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene (PubChem CID 10753103) has the molecular formula C16H24S
and a molecular weight of 248.43 g/mol. Its IUPAC name is 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene.
Molecular Properties
| Compound Name | 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene |
| PubChem CID | 10753103 |
| Molecular Formula | C16H24S |
| Molecular Weight | 248.43 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene |
| SMILES | C1CCCc2c(sc3c2CCCCCC3)CC1 |
| InChI | InChI=1S/C16H24S/c1-3-7-11-15-13(9-5-1)14-10-6-2-4-8-12-16(14)17-15/h1-12H2 |
| InChIKey | IARGKVOWVVZSTD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene?
The IUPAC name of 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene (CID 10753103) is 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene.
What is the SMILES notation for 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene?
The canonical SMILES for 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene is C1CCCc2c(sc3c2CCCCCC3)CC1.
What is the InChIKey of 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene?
The InChIKey is IARGKVOWVVZSTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24S/c1-3-7-11-15-13(9-5-1)14-10-6-2-4-8-12-16(14)17-15/h1-12H2.
What are the key properties of 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene?
10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene has a molecular weight of 248.43 g/mol, XLogP of 5.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-thiatricyclo[9.6.0.02,9]heptadeca-1(11),2(9)-diene is sourced from PubChem (CID 10753103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).