C14H16ClFN2O2 — CID 107531646
1-(2-chloro-5-fluorophenyl)-3,3-diethylpiperazine-2,5-dione (PubChem CID 107531646) has the molecular formula C14H16ClFN2O2 and a molecular weight of 298.74 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3,3-diethylpiperazine-2,5-dione.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3,3-diethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107531646 |
| Molecular Formula | C14H16ClFN2O2 |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3,3-diethylpiperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)CN(c2cc(F)ccc2Cl)C1=O |
| InChI | InChI=1S/C14H16ClFN2O2/c1-3-14(4-2)13(20)18(8-12(19)17-14)11-7-9(16)5-6-10(11)15/h5-7H,3-4,8H2,1-2H3,(H,17,19) |
| InChIKey | SREQSPXYYXIMDV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |