C10H8ClF2N5 — CID 107531935
N-(2-chloro-5-fluorophenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 107531935) has the molecular formula C10H8ClF2N5 and a molecular weight of 271.66 g/mol. Its IUPAC name is N-(2-chloro-5-fluorophenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-(2-chloro-5-fluorophenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107531935 |
| Molecular Formula | C10H8ClF2N5 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-(2-chloro-5-fluorophenyl)-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(F)c(Nc2cc(F)ccc2Cl)n1 |
| InChI | InChI=1S/C10H8ClF2N5/c11-6-2-1-5(12)3-8(6)16-9-7(13)4-15-10(17-9)18-14/h1-4H,14H2,(H2,15,16,17,18) |
| InChIKey | NVEAUSBGBYTTQK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|