About 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol
3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol (PubChem CID 10753215) has the molecular formula C12H27FO2Si
and a molecular weight of 250.43 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol |
| PubChem CID | 10753215 |
| Molecular Formula | C12H27FO2Si |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol |
| SMILES | CC(F)(CO)C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H27FO2Si/c1-10(2,3)16(7,8)15-11(4,5)12(6,13)9-14/h14H,9H2,1-8H3 |
| InChIKey | KVHSYUFIODNHNK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol (CID 10753215) is 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol is CC(F)(CO)C(C)(C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol?
The InChIKey is KVHSYUFIODNHNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27FO2Si/c1-10(2,3)16(7,8)15-11(4,5)12(6,13)9-14/h14H,9H2,1-8H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol?
3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol has a molecular weight of 250.43 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-ol is sourced from PubChem (CID 10753215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).