C12H10BrFN2O2 — CID 107532923
2-(3-bromo-4-cyano-2-fluoroanilino)pent-4-enoic acid (PubChem CID 107532923) has the molecular formula C12H10BrFN2O2 and a molecular weight of 313.13 g/mol. Its IUPAC name is 2-(3-bromo-4-cyano-2-fluoroanilino)pent-4-enoic acid.
| Compound Name | 2-(3-bromo-4-cyano-2-fluoroanilino)pent-4-enoic acid |
|---|---|
| PubChem CID | 107532923 |
| Molecular Formula | C12H10BrFN2O2 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-(3-bromo-4-cyano-2-fluoroanilino)pent-4-enoic acid |
| SMILES | C=CCC(Nc1ccc(C#N)c(Br)c1F)C(=O)O |
| InChI | InChI=1S/C12H10BrFN2O2/c1-2-3-9(12(17)18)16-8-5-4-7(6-15)10(13)11(8)14/h2,4-5,9,16H,1,3H2,(H,17,18) |
| InChIKey | MBQFUQUPUVVCES-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|