About 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile
5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile (PubChem CID 10753434) has the molecular formula C13H14N6
and a molecular weight of 254.30 g/mol. Its IUPAC name is 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile |
| PubChem CID | 10753434 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile |
| SMILES | C=CCNc1nc(C#N)c(C#N)nc1N1CCCC1 |
| InChI | InChI=1S/C13H14N6/c1-2-5-16-12-13(19-6-3-4-7-19)18-11(9-15)10(8-14)17-12/h2H,1,3-7H2,(H,16,17) |
| InChIKey | QAYTWEVFOPYPGK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile?
The IUPAC name of 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile (CID 10753434) is 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile is C=CCNc1nc(C#N)c(C#N)nc1N1CCCC1.
What is the InChIKey of 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile?
The InChIKey is QAYTWEVFOPYPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N6/c1-2-5-16-12-13(19-6-3-4-7-19)18-11(9-15)10(8-14)17-12/h2H,1,3-7H2,(H,16,17).
What are the key properties of 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile?
5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile has a molecular weight of 254.30 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(prop-2-enylamino)-6-pyrrolidin-1-ylpyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 10753434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).