C13H26BNO3 — CID 10753489
(Z)-N-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-imine (PubChem CID 10753489) has the molecular formula C13H26BNO3 and a molecular weight of 255.17 g/mol. Its IUPAC name is (Z)-N-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-imine.
| Compound Name | (Z)-N-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-imine |
|---|---|
| PubChem CID | 10753489 |
| Molecular Formula | C13H26BNO3 |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (Z)-N-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-3-imine |
| SMILES | CCC/C(CCB1OC(C)(C)C(C)(C)O1)=N\OC |
| InChI | InChI=1S/C13H26BNO3/c1-7-8-11(15-16-6)9-10-14-17-12(2,3)13(4,5)18-14/h7-10H2,1-6H3/b15-11+ |
| InChIKey | LNWADBRGAOYQPJ-RVDMUPIBSA-N |
| XLogP | 3.27 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|