C15H16NOP — CID 10753618
(2R,3S)-2-diphenylphosphoryl-3-methylaziridine (PubChem CID 10753618) has the molecular formula C15H16NOP and a molecular weight of 257.27 g/mol. Its IUPAC name is (2R,3S)-2-diphenylphosphoryl-3-methylaziridine.
| Compound Name | (2R,3S)-2-diphenylphosphoryl-3-methylaziridine |
|---|---|
| PubChem CID | 10753618 |
| Molecular Formula | C15H16NOP |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (2R,3S)-2-diphenylphosphoryl-3-methylaziridine |
| SMILES | C[C@@H]1N[C@@H]1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16NOP/c1-12-15(16-12)18(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15-16H,1H3/t12-,15+/m0/s1 |
| InChIKey | HWNAZOLOCQIKJE-SWLSCSKDSA-N |
| XLogP | 2.32 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|