C12H12BrF2N3OS — CID 107537217
(1S)-1-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropan-1-amine (PubChem CID 107537217) has the molecular formula C12H12BrF2N3OS and a molecular weight of 364.22 g/mol. Its IUPAC name is (1S)-1-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropan-1-amine.
| Compound Name | (1S)-1-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 107537217 |
| Molecular Formula | C12H12BrF2N3OS |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (1S)-1-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylsulfanylpropan-1-amine |
| SMILES | CSCC[C@H](N)c1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C12H12BrF2N3OS/c1-20-5-4-8(16)12-17-11(18-19-12)6-2-3-7(14)10(15)9(6)13/h2-3,8H,4-5,16H2,1H3/t8-/m0/s1 |
| InChIKey | FCEUQYMFEIXROI-QMMMGPOBSA-N |
| XLogP | 3.53 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|