About [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane
[(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane (PubChem CID 10753722) has the molecular formula C14H30O2Si
and a molecular weight of 258.48 g/mol. Its IUPAC name is [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane |
| PubChem CID | 10753722 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane |
| SMILES | CCC[C@@H](OCOC)[C@H](C)C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-7-9-14(16-12-15-3)13(2)10-8-11-17(4,5)6/h8,11,13-14H,7,9-10,12H2,1-6H3/b11-8+/t13-,14-/m1/s1 |
| InChIKey | RTXRYIXIZLWSOZ-DVFZLIDBSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane?
The IUPAC name of [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane (CID 10753722) is [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane.
What is the SMILES notation for [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane?
The canonical SMILES for [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane is CCC[C@@H](OCOC)[C@H](C)C/C=C/[Si](C)(C)C.
What is the InChIKey of [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane?
The InChIKey is RTXRYIXIZLWSOZ-DVFZLIDBSA-N. The full InChI is InChI=1S/C14H30O2Si/c1-7-9-14(16-12-15-3)13(2)10-8-11-17(4,5)6/h8,11,13-14H,7,9-10,12H2,1-6H3/b11-8+/t13-,14-/m1/s1.
What are the key properties of [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane?
[(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane has a molecular weight of 258.48 g/mol, XLogP of 4.24, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4R,5R)-5-(methoxymethoxy)-4-methyloct-1-enyl]-trimethylsilane is sourced from PubChem (CID 10753722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).