C13H17N5O — CID 10753773
(11R,15S)-8-ethyl-4-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one (PubChem CID 10753773) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is (11R,15S)-8-ethyl-4-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one.
| Compound Name | (11R,15S)-8-ethyl-4-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 10753773 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (11R,15S)-8-ethyl-4-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
| SMILES | CCN1C(=O)c2[nH]c(C)nc2N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C13H17N5O/c1-3-17-12(19)10-11(15-7(2)14-10)18-9-6-4-5-8(9)16-13(17)18/h8-9H,3-6H2,1-2H3,(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | QMINYJDOFVFKDZ-BDAKNGLRSA-N |
| XLogP | 1.29 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |