C14H21NSi2 — CID 10753796
1-(4-ethynylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 10753796) has the molecular formula C14H21NSi2 and a molecular weight of 259.50 g/mol. Its IUPAC name is 1-(4-ethynylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-(4-ethynylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 10753796 |
| Molecular Formula | C14H21NSi2 |
| Molecular Weight | 259.50 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-(4-ethynylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C#Cc1ccc(N2[Si](C)(C)CC[Si]2(C)C)cc1 |
| InChI | InChI=1S/C14H21NSi2/c1-6-13-7-9-14(10-8-13)15-16(2,3)11-12-17(15,4)5/h1,7-10H,11-12H2,2-5H3 |
| InChIKey | IGIZXTWKYHCABX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|