C13H12BrClF2N2O — CID 107538287
(2-bromo-3,4-difluorophenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol (PubChem CID 107538287) has the molecular formula C13H12BrClF2N2O and a molecular weight of 365.61 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 107538287 |
| Molecular Formula | C13H12BrClF2N2O |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanol |
| SMILES | CC(C)n1ncc(Cl)c1C(O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C13H12BrClF2N2O/c1-6(2)19-12(8(15)5-18-19)13(20)7-3-4-9(16)11(17)10(7)14/h3-6,13,20H,1-2H3 |
| InChIKey | MWMAGPYSVHUNTF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|