C14H15BrF2N2O — CID 107538543
1-(2-bromo-3,4-difluorophenyl)-2-(1-propylimidazol-2-yl)ethanol (PubChem CID 107538543) has the molecular formula C14H15BrF2N2O and a molecular weight of 345.19 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(1-propylimidazol-2-yl)ethanol.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(1-propylimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107538543 |
| Molecular Formula | C14H15BrF2N2O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(1-propylimidazol-2-yl)ethanol |
| SMILES | CCCn1ccnc1CC(O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C14H15BrF2N2O/c1-2-6-19-7-5-18-12(19)8-11(20)9-3-4-10(16)14(17)13(9)15/h3-5,7,11,20H,2,6,8H2,1H3 |
| InChIKey | DGQORPYADINAGO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|