C16H12BrF2NO — CID 107538891
(2-bromo-3,4-difluorophenyl)-(5-methyl-1-benzofuran-2-yl)methanamine (PubChem CID 107538891) has the molecular formula C16H12BrF2NO and a molecular weight of 352.18 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(5-methyl-1-benzofuran-2-yl)methanamine.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(5-methyl-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 107538891 |
| Molecular Formula | C16H12BrF2NO |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(5-methyl-1-benzofuran-2-yl)methanamine |
| SMILES | Cc1ccc2oc(C(N)c3ccc(F)c(F)c3Br)cc2c1 |
| InChI | InChI=1S/C16H12BrF2NO/c1-8-2-5-12-9(6-8)7-13(21-12)16(20)10-3-4-11(18)15(19)14(10)17/h2-7,16H,20H2,1H3 |
| InChIKey | ABCNWTZCSCXSCC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|