About N-(furan-2-ylmethyl)-1,1-diphenylmethanimine
N-(furan-2-ylmethyl)-1,1-diphenylmethanimine (PubChem CID 10753892) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-1,1-diphenylmethanimine |
| PubChem CID | 10753892 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,1-diphenylmethanimine |
| SMILES | c1ccc(C(=NCc2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NO/c1-3-8-15(9-4-1)18(16-10-5-2-6-11-16)19-14-17-12-7-13-20-17/h1-13H,14H2 |
| InChIKey | IXCYSZYTFBDIST-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(furan-2-ylmethyl)-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-1,1-diphenylmethanimine?
The IUPAC name of N-(furan-2-ylmethyl)-1,1-diphenylmethanimine (CID 10753892) is N-(furan-2-ylmethyl)-1,1-diphenylmethanimine.
What is the SMILES notation for N-(furan-2-ylmethyl)-1,1-diphenylmethanimine?
The canonical SMILES for N-(furan-2-ylmethyl)-1,1-diphenylmethanimine is c1ccc(C(=NCc2ccco2)c2ccccc2)cc1.
What is the InChIKey of N-(furan-2-ylmethyl)-1,1-diphenylmethanimine?
The InChIKey is IXCYSZYTFBDIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO/c1-3-8-15(9-4-1)18(16-10-5-2-6-11-16)19-14-17-12-7-13-20-17/h1-13H,14H2.
What are the key properties of N-(furan-2-ylmethyl)-1,1-diphenylmethanimine?
N-(furan-2-ylmethyl)-1,1-diphenylmethanimine has a molecular weight of 261.32 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-1,1-diphenylmethanimine is sourced from PubChem (CID 10753892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).