About 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine
5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine (PubChem CID 10753919) has the molecular formula C10H10N6O3
and a molecular weight of 262.23 g/mol. Its IUPAC name is 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine |
| PubChem CID | 10753919 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c([N+](=O)[O-])c(OCc2cccnc2)n1 |
| InChI | InChI=1S/C10H10N6O3/c11-8-7(16(17)18)9(15-10(12)14-8)19-5-6-2-1-3-13-4-6/h1-4H,5H2,(H4,11,12,14,15) |
| InChIKey | RKEKPSQLKNKPKS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine?
The IUPAC name of 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine (CID 10753919) is 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine?
The canonical SMILES for 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine is Nc1nc(N)c([N+](=O)[O-])c(OCc2cccnc2)n1.
What is the InChIKey of 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine?
The InChIKey is RKEKPSQLKNKPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6O3/c11-8-7(16(17)18)9(15-10(12)14-8)19-5-6-2-1-3-13-4-6/h1-4H,5H2,(H4,11,12,14,15).
What are the key properties of 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine?
5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine has a molecular weight of 262.23 g/mol, XLogP of 0.52, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-6-(pyridin-3-ylmethoxy)pyrimidine-2,4-diamine is sourced from PubChem (CID 10753919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).