C15H15BrF2N2O — CID 107539197
N-[(2-bromo-3,4-difluorophenyl)-(5-methoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 107539197) has the molecular formula C15H15BrF2N2O and a molecular weight of 357.20 g/mol. Its IUPAC name is N-[(2-bromo-3,4-difluorophenyl)-(5-methoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-3,4-difluorophenyl)-(5-methoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107539197 |
| Molecular Formula | C15H15BrF2N2O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | N-[(2-bromo-3,4-difluorophenyl)-(5-methoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1cncc(OC)c1)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H15BrF2N2O/c1-3-20-15(9-6-10(21-2)8-19-7-9)11-4-5-12(17)14(18)13(11)16/h4-8,15,20H,3H2,1-2H3 |
| InChIKey | ONPSNVKGMAELIN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|