C14H18BrFN2O2 — CID 107540427
2-bromo-4-[(1,2-dimethylpiperidin-4-yl)amino]-3-fluorobenzoic acid (PubChem CID 107540427) has the molecular formula C14H18BrFN2O2 and a molecular weight of 345.21 g/mol. Its IUPAC name is 2-bromo-4-[(1,2-dimethylpiperidin-4-yl)amino]-3-fluorobenzoic acid.
| Compound Name | 2-bromo-4-[(1,2-dimethylpiperidin-4-yl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107540427 |
| Molecular Formula | C14H18BrFN2O2 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-bromo-4-[(1,2-dimethylpiperidin-4-yl)amino]-3-fluorobenzoic acid |
| SMILES | CC1CC(Nc2ccc(C(=O)O)c(Br)c2F)CCN1C |
| InChI | InChI=1S/C14H18BrFN2O2/c1-8-7-9(5-6-18(8)2)17-11-4-3-10(14(19)20)12(15)13(11)16/h3-4,8-9,17H,5-7H2,1-2H3,(H,19,20) |
| InChIKey | IXPYQTLNYJFAGY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |