C14H17BrFNO2 — CID 107540517
2-bromo-4-(3,4-dimethylpiperidin-1-yl)-3-fluorobenzoic acid (PubChem CID 107540517) has the molecular formula C14H17BrFNO2 and a molecular weight of 330.20 g/mol. Its IUPAC name is 2-bromo-4-(3,4-dimethylpiperidin-1-yl)-3-fluorobenzoic acid.
| Compound Name | 2-bromo-4-(3,4-dimethylpiperidin-1-yl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107540517 |
| Molecular Formula | C14H17BrFNO2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-bromo-4-(3,4-dimethylpiperidin-1-yl)-3-fluorobenzoic acid |
| SMILES | CC1CCN(c2ccc(C(=O)O)c(Br)c2F)CC1C |
| InChI | InChI=1S/C14H17BrFNO2/c1-8-5-6-17(7-9(8)2)11-4-3-10(14(18)19)12(15)13(11)16/h3-4,8-9H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | SYXYOSSTXMAWLE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |