C11H5BrF2N2O — CID 107540895
2-(2-bromo-3,4-difluorophenyl)pyrimidine-4-carbaldehyde (PubChem CID 107540895) has the molecular formula C11H5BrF2N2O and a molecular weight of 299.07 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)pyrimidine-4-carbaldehyde.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 107540895 |
| Molecular Formula | C11H5BrF2N2O |
| Molecular Weight | 299.07 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)pyrimidine-4-carbaldehyde |
| SMILES | O=Cc1ccnc(-c2ccc(F)c(F)c2Br)n1 |
| InChI | InChI=1S/C11H5BrF2N2O/c12-9-7(1-2-8(13)10(9)14)11-15-4-3-6(5-17)16-11/h1-5H |
| InChIKey | YSGJXCCXORUGTM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|