About 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione
2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione (PubChem CID 107541422) has the molecular formula C14H13BrF2N2S
and a molecular weight of 359.24 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione |
| PubChem CID | 107541422 |
| Molecular Formula | C14H13BrF2N2S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione |
| SMILES | CC(C)(C)c1cc(=S)nc(-c2ccc(F)c(F)c2Br)[nH]1 |
| InChI | InChI=1S/C14H13BrF2N2S/c1-14(2,3)9-6-10(20)19-13(18-9)7-4-5-8(16)12(17)11(7)15/h4-6H,1-3H3,(H,18,19,20) |
| InChIKey | FEQAQVJJGHARML-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione?
The IUPAC name of 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione (CID 107541422) is 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione.
What is the SMILES notation for 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione?
The canonical SMILES for 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione is CC(C)(C)c1cc(=S)nc(-c2ccc(F)c(F)c2Br)[nH]1.
What is the InChIKey of 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione?
The InChIKey is FEQAQVJJGHARML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrF2N2S/c1-14(2,3)9-6-10(20)19-13(18-9)7-4-5-8(16)12(17)11(7)15/h4-6H,1-3H3,(H,18,19,20).
What are the key properties of 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione?
2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione has a molecular weight of 359.24 g/mol, XLogP of 5.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-3,4-difluorophenyl)-6-tert-butyl-1H-pyrimidine-4-thione is sourced from PubChem (CID 107541422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).