About [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine
[6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine (PubChem CID 107541777) has the molecular formula C10H16N4OS
and a molecular weight of 240.33 g/mol. Its IUPAC name is [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine |
| PubChem CID | 107541777 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine |
| SMILES | Cc1cc(CN)nc(N2CCS(=O)CC2)n1 |
| InChI | InChI=1S/C10H16N4OS/c1-8-6-9(7-11)13-10(12-8)14-2-4-16(15)5-3-14/h6H,2-5,7,11H2,1H3 |
| InChIKey | OCPIKMRUSXVAMN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine?
The IUPAC name of [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine (CID 107541777) is [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine.
What is the SMILES notation for [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine?
The canonical SMILES for [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine is Cc1cc(CN)nc(N2CCS(=O)CC2)n1.
What is the InChIKey of [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine?
The InChIKey is OCPIKMRUSXVAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS/c1-8-6-9(7-11)13-10(12-8)14-2-4-16(15)5-3-14/h6H,2-5,7,11H2,1H3.
What are the key properties of [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine?
[6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine has a molecular weight of 240.33 g/mol, XLogP of -0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-2-(1-oxo-1,4-thiazinan-4-yl)pyrimidin-4-yl]methanamine is sourced from PubChem (CID 107541777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).