C15H19ClO2 — CID 10754273
(3aS,6E,10E,11aR)-6-(chloromethyl)-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 10754273) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-6-(chloromethyl)-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,6E,10E,11aR)-6-(chloromethyl)-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 10754273 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3aS,6E,10E,11aR)-6-(chloromethyl)-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(/CCl)CC[C@@H]12 |
| InChI | InChI=1S/C15H19ClO2/c1-10-4-3-5-12(9-16)6-7-13-11(2)15(17)18-14(13)8-10/h5,8,13-14H,2-4,6-7,9H2,1H3/b10-8+,12-5+/t13-,14+/m0/s1 |
| InChIKey | GEGJZVYINFLKIZ-HEZJRNALSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|