C13H16N4O3 — CID 107543056
4-[(4-cyano-6-methylpyrimidin-2-yl)-ethylamino]oxolane-3-carboxylic acid (PubChem CID 107543056) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-[(4-cyano-6-methylpyrimidin-2-yl)-ethylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(4-cyano-6-methylpyrimidin-2-yl)-ethylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 107543056 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-[(4-cyano-6-methylpyrimidin-2-yl)-ethylamino]oxolane-3-carboxylic acid |
| SMILES | CCN(c1nc(C)cc(C#N)n1)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H16N4O3/c1-3-17(11-7-20-6-10(11)12(18)19)13-15-8(2)4-9(5-14)16-13/h4,10-11H,3,6-7H2,1-2H3,(H,18,19) |
| InChIKey | YJBLQEQQPAGVBR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |