About 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile
2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107543941) has the molecular formula C12H13N5S
and a molecular weight of 259.34 g/mol. Its IUPAC name is 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile |
| PubChem CID | 107543941 |
| Molecular Formula | C12H13N5S |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | CCc1nc(Nc2nc(C)cc(C#N)n2)sc1C |
| InChI | InChI=1S/C12H13N5S/c1-4-10-8(3)18-12(16-10)17-11-14-7(2)5-9(6-13)15-11/h5H,4H2,1-3H3,(H,14,15,16,17) |
| InChIKey | PSIZCKPOYWIHKH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile?
The IUPAC name of 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile (CID 107543941) is 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile.
What is the SMILES notation for 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile?
The canonical SMILES for 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile is CCc1nc(Nc2nc(C)cc(C#N)n2)sc1C.
What is the InChIKey of 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile?
The InChIKey is PSIZCKPOYWIHKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5S/c1-4-10-8(3)18-12(16-10)17-11-14-7(2)5-9(6-13)15-11/h5H,4H2,1-3H3,(H,14,15,16,17).
What are the key properties of 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile?
2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile has a molecular weight of 259.34 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethyl-5-methyl-1,3-thiazol-2-yl)amino]-6-methylpyrimidine-4-carbonitrile is sourced from PubChem (CID 107543941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).