About 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile
2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile (PubChem CID 107543959) has the molecular formula C11H9N5S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile |
| PubChem CID | 107543959 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ccnc(Nc2nc(C3CC3)cs2)n1 |
| InChI | InChI=1S/C11H9N5S/c12-5-8-3-4-13-10(14-8)16-11-15-9(6-17-11)7-1-2-7/h3-4,6-7H,1-2H2,(H,13,14,15,16) |
| InChIKey | ZOOYIVJKFLAFHT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
The IUPAC name of 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile (CID 107543959) is 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile.
What is the SMILES notation for 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
The canonical SMILES for 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile is N#Cc1ccnc(Nc2nc(C3CC3)cs2)n1.
What is the InChIKey of 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
The InChIKey is ZOOYIVJKFLAFHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5S/c12-5-8-3-4-13-10(14-8)16-11-15-9(6-17-11)7-1-2-7/h3-4,6-7H,1-2H2,(H,13,14,15,16).
What are the key properties of 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile has a molecular weight of 243.29 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile is sourced from PubChem (CID 107543959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).