C17H19NO2 — CID 10754455
(4R,4aR,7aS)-2-benzylspiro[1,4a,7,7a-tetrahydrocyclopenta[c]pyridine-4,2'-oxetane]-3-one (PubChem CID 10754455) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (4R,4aR,7aS)-2-benzylspiro[1,4a,7,7a-tetrahydrocyclopenta[c]pyridine-4,2'-oxetane]-3-one.
| Compound Name | (4R,4aR,7aS)-2-benzylspiro[1,4a,7,7a-tetrahydrocyclopenta[c]pyridine-4,2'-oxetane]-3-one |
|---|---|
| PubChem CID | 10754455 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (4R,4aR,7aS)-2-benzylspiro[1,4a,7,7a-tetrahydrocyclopenta[c]pyridine-4,2'-oxetane]-3-one |
| SMILES | O=C1N(Cc2ccccc2)C[C@H]2CC=C[C@H]2[C@]12CCO2 |
| InChI | InChI=1S/C17H19NO2/c19-16-17(9-10-20-17)15-8-4-7-14(15)12-18(16)11-13-5-2-1-3-6-13/h1-6,8,14-15H,7,9-12H2/t14-,15-,17-/m1/s1 |
| InChIKey | LRIVKPGIKDFXMG-BFYDXBDKSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|