About 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile
2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107544744) has the molecular formula C11H11N5O2
and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile |
| PubChem CID | 107544744 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NC2CCC(=O)NC2=O)n1 |
| InChI | InChI=1S/C11H11N5O2/c1-6-4-7(5-12)14-11(13-6)15-8-2-3-9(17)16-10(8)18/h4,8H,2-3H2,1H3,(H,13,14,15)(H,16,17,18) |
| InChIKey | PVFFHFVPYWKXNN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile?
The IUPAC name of 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile (CID 107544744) is 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile.
What is the SMILES notation for 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile?
The canonical SMILES for 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile is Cc1cc(C#N)nc(NC2CCC(=O)NC2=O)n1.
What is the InChIKey of 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile?
The InChIKey is PVFFHFVPYWKXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O2/c1-6-4-7(5-12)14-11(13-6)15-8-2-3-9(17)16-10(8)18/h4,8H,2-3H2,1H3,(H,13,14,15)(H,16,17,18).
What are the key properties of 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile?
2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile has a molecular weight of 245.24 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dioxopiperidin-3-yl)amino]-6-methylpyrimidine-4-carbonitrile is sourced from PubChem (CID 107544744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).