About 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile
6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile (PubChem CID 107544746) has the molecular formula C12H13N5O2
and a molecular weight of 259.27 g/mol. Its IUPAC name is 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile |
| PubChem CID | 107544746 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NC2CCC(=O)N(C)C2=O)n1 |
| InChI | InChI=1S/C12H13N5O2/c1-7-5-8(6-13)15-12(14-7)16-9-3-4-10(18)17(2)11(9)19/h5,9H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | CFXOULZZFHUWIH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile?
The IUPAC name of 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile (CID 107544746) is 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile.
What is the SMILES notation for 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile?
The canonical SMILES for 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile is Cc1cc(C#N)nc(NC2CCC(=O)N(C)C2=O)n1.
What is the InChIKey of 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile?
The InChIKey is CFXOULZZFHUWIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O2/c1-7-5-8(6-13)15-12(14-7)16-9-3-4-10(18)17(2)11(9)19/h5,9H,3-4H2,1-2H3,(H,14,15,16).
What are the key properties of 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile?
6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile has a molecular weight of 259.27 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile is sourced from PubChem (CID 107544746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).