C11H11N5O2 — CID 107544747
2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile (PubChem CID 107544747) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile.
| Compound Name | 2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107544747 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]pyrimidine-4-carbonitrile |
| SMILES | CN1C(=O)CCC(Nc2nccc(C#N)n2)C1=O |
| InChI | InChI=1S/C11H11N5O2/c1-16-9(17)3-2-8(10(16)18)15-11-13-5-4-7(6-12)14-11/h4-5,8H,2-3H2,1H3,(H,13,14,15) |
| InChIKey | PEOURZWCVLGBPZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|