C18H22O2 — CID 10754528
(6S,6aS)-4-pentyl-6-phenyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 10754528) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (6S,6aS)-4-pentyl-6-phenyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (6S,6aS)-4-pentyl-6-phenyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 10754528 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (6S,6aS)-4-pentyl-6-phenyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | CCCCCC1=C2COC[C@H]2[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C18H22O2/c1-2-3-5-10-14-15-11-20-12-16(15)17(18(14)19)13-8-6-4-7-9-13/h4,6-9,16-17H,2-3,5,10-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | UZFGHMXDRJQDJE-IAGOWNOFSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|