About 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile
6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile (PubChem CID 107545313) has the molecular formula C9H8N6S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile |
| PubChem CID | 107545313 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(Nc2nc(C)ns2)n1 |
| InChI | InChI=1S/C9H8N6S/c1-5-3-7(4-10)13-8(11-5)14-9-12-6(2)15-16-9/h3H,1-2H3,(H,11,12,13,14,15) |
| InChIKey | DPPMITFKAQKELH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile?
The IUPAC name of 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile (CID 107545313) is 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile.
What is the SMILES notation for 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile?
The canonical SMILES for 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile is Cc1cc(C#N)nc(Nc2nc(C)ns2)n1.
What is the InChIKey of 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile?
The InChIKey is DPPMITFKAQKELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6S/c1-5-3-7(4-10)13-8(11-5)14-9-12-6(2)15-16-9/h3H,1-2H3,(H,11,12,13,14,15).
What are the key properties of 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile?
6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile has a molecular weight of 232.27 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbonitrile is sourced from PubChem (CID 107545313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).