C14H18N4 — CID 107545360
2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)pyrimidine-4-carbonitrile (PubChem CID 107545360) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)pyrimidine-4-carbonitrile.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545360 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)pyrimidine-4-carbonitrile |
| SMILES | CC(C)(C)C1=CCN(c2nccc(C#N)n2)CC1 |
| InChI | InChI=1S/C14H18N4/c1-14(2,3)11-5-8-18(9-6-11)13-16-7-4-12(10-15)17-13/h4-5,7H,6,8-9H2,1-3H3 |
| InChIKey | MKIPSUMVBUCXKN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|