C15H17N3O2 — CID 10754585
(1S,2R,7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,5-diene-10,12-dione (PubChem CID 10754585) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (1S,2R,7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,5-diene-10,12-dione.
| Compound Name | (1S,2R,7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,5-diene-10,12-dione |
|---|---|
| PubChem CID | 10754585 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (1S,2R,7S,8R)-11-methyl-9,11,13-triazapentacyclo[6.5.2.22,7.02,7.09,13]heptadeca-3,5-diene-10,12-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1CC[C@H]2[C@]23C=CC=C[C@]12CC3 |
| InChI | InChI=1S/C15H17N3O2/c1-16-12(19)17-10-4-5-11(18(17)13(16)20)15-7-3-2-6-14(10,15)8-9-15/h2-3,6-7,10-11H,4-5,8-9H2,1H3/t10-,11+,14+,15- |
| InChIKey | UQWUFTDIJCXJNG-AGCIHXOGSA-N |
| XLogP | 1.13 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |