C7H10N4S — CID 107546167
6-methyl-2-(methylamino)pyrimidine-4-carbothioamide (PubChem CID 107546167) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is 6-methyl-2-(methylamino)pyrimidine-4-carbothioamide.
| Compound Name | 6-methyl-2-(methylamino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546167 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 6-methyl-2-(methylamino)pyrimidine-4-carbothioamide |
| SMILES | CNc1nc(C)cc(C(N)=S)n1 |
| InChI | InChI=1S/C7H10N4S/c1-4-3-5(6(8)12)11-7(9-2)10-4/h3H,1-2H3,(H2,8,12)(H,9,10,11) |
| InChIKey | ILCNPLAMUUDBEK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|