C12H19N5OS — CID 107547005
2-[(4-carbamothioyl-6-methylpyrimidin-2-yl)-ethylamino]-N-ethylacetamide (PubChem CID 107547005) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[(4-carbamothioyl-6-methylpyrimidin-2-yl)-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[(4-carbamothioyl-6-methylpyrimidin-2-yl)-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 107547005 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-[(4-carbamothioyl-6-methylpyrimidin-2-yl)-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)c1nc(C)cc(C(N)=S)n1 |
| InChI | InChI=1S/C12H19N5OS/c1-4-14-10(18)7-17(5-2)12-15-8(3)6-9(16-12)11(13)19/h6H,4-5,7H2,1-3H3,(H2,13,19)(H,14,18) |
| InChIKey | XUMYDBHQXNOSOJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|