C12H19N5S — CID 107547375
2-[2-[cyclopropyl(methyl)amino]ethylamino]-6-methylpyrimidine-4-carbothioamide (PubChem CID 107547375) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 2-[2-[cyclopropyl(methyl)amino]ethylamino]-6-methylpyrimidine-4-carbothioamide.
| Compound Name | 2-[2-[cyclopropyl(methyl)amino]ethylamino]-6-methylpyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547375 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-[2-[cyclopropyl(methyl)amino]ethylamino]-6-methylpyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(NCCN(C)C2CC2)n1 |
| InChI | InChI=1S/C12H19N5S/c1-8-7-10(11(13)18)16-12(15-8)14-5-6-17(2)9-3-4-9/h7,9H,3-6H2,1-2H3,(H2,13,18)(H,14,15,16) |
| InChIKey | ZNAZXUXDRRLPBH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|