C10H16N4S2 — CID 107547939
2-[methyl(1-methylsulfanylpropan-2-yl)amino]pyrimidine-4-carbothioamide (PubChem CID 107547939) has the molecular formula C10H16N4S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-[methyl(1-methylsulfanylpropan-2-yl)amino]pyrimidine-4-carbothioamide.
| Compound Name | 2-[methyl(1-methylsulfanylpropan-2-yl)amino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547939 |
| Molecular Formula | C10H16N4S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[methyl(1-methylsulfanylpropan-2-yl)amino]pyrimidine-4-carbothioamide |
| SMILES | CSCC(C)N(C)c1nccc(C(N)=S)n1 |
| InChI | InChI=1S/C10H16N4S2/c1-7(6-16-3)14(2)10-12-5-4-8(13-10)9(11)15/h4-5,7H,6H2,1-3H3,(H2,11,15) |
| InChIKey | JDGSVZVBCUBFJU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|