About 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene
3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene (PubChem CID 10754802) has the molecular formula C17H22O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene.
Molecular Properties
| Compound Name | 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene |
| PubChem CID | 10754802 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene |
| SMILES | COC1(c2ccccc2)C=CC2(CCCCCC2)OO1 |
| InChI | InChI=1S/C17H22O3/c1-18-17(15-9-5-4-6-10-15)14-13-16(19-20-17)11-7-2-3-8-12-16/h4-6,9-10,13-14H,2-3,7-8,11-12H2,1H3 |
| InChIKey | PICBSKIARMMKNB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene?
The IUPAC name of 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene (CID 10754802) is 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene.
What is the SMILES notation for 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene?
The canonical SMILES for 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene is COC1(c2ccccc2)C=CC2(CCCCCC2)OO1.
What is the InChIKey of 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene?
The InChIKey is PICBSKIARMMKNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O3/c1-18-17(15-9-5-4-6-10-15)14-13-16(19-20-17)11-7-2-3-8-12-16/h4-6,9-10,13-14H,2-3,7-8,11-12H2,1H3.
What are the key properties of 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene?
3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene has a molecular weight of 274.36 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-3-phenyl-1,2-dioxaspiro[5.6]dodec-4-ene is sourced from PubChem (CID 10754802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).