C9H10N6S2 — CID 107548119
6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbothioamide (PubChem CID 107548119) has the molecular formula C9H10N6S2 and a molecular weight of 266.36 g/mol. Its IUPAC name is 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbothioamide.
| Compound Name | 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548119 |
| Molecular Formula | C9H10N6S2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]pyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(Nc2nc(C)ns2)n1 |
| InChI | InChI=1S/C9H10N6S2/c1-4-3-6(7(10)16)13-8(11-4)14-9-12-5(2)15-17-9/h3H,1-2H3,(H2,10,16)(H,11,12,13,14,15) |
| InChIKey | OJXURDNNONVTPY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|