About 2-bromo-3-octylthiophene
2-bromo-3-octylthiophene (PubChem CID 10754854) has the molecular formula C12H19BrS
and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-bromo-3-octylthiophene.
Molecular Properties
| Compound Name | 2-bromo-3-octylthiophene |
| PubChem CID | 10754854 |
| Molecular Formula | C12H19BrS |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-bromo-3-octylthiophene |
| SMILES | CCCCCCCCc1ccsc1Br |
| InChI | InChI=1S/C12H19BrS/c1-2-3-4-5-6-7-8-11-9-10-14-12(11)13/h9-10H,2-8H2,1H3 |
| InChIKey | ISONQKSIWXLJOQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-octylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-octylthiophene?
The IUPAC name of 2-bromo-3-octylthiophene (CID 10754854) is 2-bromo-3-octylthiophene.
What is the SMILES notation for 2-bromo-3-octylthiophene?
The canonical SMILES for 2-bromo-3-octylthiophene is CCCCCCCCc1ccsc1Br.
What is the InChIKey of 2-bromo-3-octylthiophene?
The InChIKey is ISONQKSIWXLJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrS/c1-2-3-4-5-6-7-8-11-9-10-14-12(11)13/h9-10H,2-8H2,1H3.
What are the key properties of 2-bromo-3-octylthiophene?
2-bromo-3-octylthiophene has a molecular weight of 275.25 g/mol, XLogP of 5.41, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-octylthiophene is sourced from PubChem (CID 10754854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).