About [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate
[(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate (PubChem CID 10754927) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate |
| PubChem CID | 10754927 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](C)OC(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H20O4/c1-10(2)15(17)20-14-11(3)19-16(18)13(14)9-12-7-5-4-6-8-12/h4-8,10-11,13-14H,9H2,1-3H3/t11-,13+,14-/m0/s1 |
| InChIKey | YUJNBEBWSKQCOY-YUTCNCBUSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate?
The IUPAC name of [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate (CID 10754927) is [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate.
What is the SMILES notation for [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate?
The canonical SMILES for [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate is CC(C)C(=O)O[C@H]1[C@H](C)OC(=O)[C@@H]1Cc1ccccc1.
What is the InChIKey of [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate?
The InChIKey is YUJNBEBWSKQCOY-YUTCNCBUSA-N. The full InChI is InChI=1S/C16H20O4/c1-10(2)15(17)20-14-11(3)19-16(18)13(14)9-12-7-5-4-6-8-12/h4-8,10-11,13-14H,9H2,1-3H3/t11-,13+,14-/m0/s1.
What are the key properties of [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate?
[(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate has a molecular weight of 276.33 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R,4R)-4-benzyl-2-methyl-5-oxooxolan-3-yl] 2-methylpropanoate is sourced from PubChem (CID 10754927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).