2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride

C7HClF6N2O — CID 10755093

IUPAC2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride
SMILESO=C(Cl)c1cnc(C(F)(F)F)nc1C(F)(F)F
InChIInChI=1S/C7HClF6N2O/c8-4(17)2-1-15-5(7(12,13)14)16-3(2)6(9,10)11/h1H
InChIKeyRBAGVCLDZXWDJZ-UHFFFAOYSA-N
MW278.54 g/mol
LogP2.89
Rot. Bonds1

About 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride

2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride (PubChem CID 10755093) has the molecular formula C7HClF6N2O and a molecular weight of 278.54 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride.

Molecular Properties

Compound Name2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride
PubChem CID10755093
Molecular FormulaC7HClF6N2O
Molecular Weight278.54 g/mol
Exact Mass277.97
IUPAC Name2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride
SMILESO=C(Cl)c1cnc(C(F)(F)F)nc1C(F)(F)F
InChIInChI=1S/C7HClF6N2O/c8-4(17)2-1-15-5(7(12,13)14)16-3(2)6(9,10)11/h1H
InChIKeyRBAGVCLDZXWDJZ-UHFFFAOYSA-N
XLogP2.89
TPSA42.85 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.54
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride?
The IUPAC name of 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride (CID 10755093) is 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride.
What is the SMILES notation for 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride?
The canonical SMILES for 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride is O=C(Cl)c1cnc(C(F)(F)F)nc1C(F)(F)F.
What is the InChIKey of 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride?
The InChIKey is RBAGVCLDZXWDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HClF6N2O/c8-4(17)2-1-15-5(7(12,13)14)16-3(2)6(9,10)11/h1H.
What are the key properties of 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride?
2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride has a molecular weight of 278.54 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(trifluoromethyl)pyrimidine-5-carbonyl chloride is sourced from PubChem (CID 10755093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).