C8H8F4N4O — CID 107550985
2-(2,2,3,3-tetrafluoropropoxy)pyrimidine-4-carboximidamide (PubChem CID 107550985) has the molecular formula C8H8F4N4O and a molecular weight of 252.17 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)pyrimidine-4-carboximidamide.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550985 |
| Molecular Formula | C8H8F4N4O |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C8H8F4N4O/c9-6(10)8(11,12)3-17-7-15-2-1-4(16-7)5(13)14/h1-2,6H,3H2,(H3,13,14) |
| InChIKey | JSVWBSXYUIWGQG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|