About 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide
2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide (PubChem CID 107551218) has the molecular formula C8H9F3N4O
and a molecular weight of 234.18 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide.
Molecular Properties
| Compound Name | 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide |
| PubChem CID | 107551218 |
| Molecular Formula | C8H9F3N4O |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(OCCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H9F3N4O/c9-8(10,11)2-4-16-7-14-3-1-5(15-7)6(12)13/h1,3H,2,4H2,(H3,12,13) |
| InChIKey | WRQBZNCWNGQDHK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide?
The IUPAC name of 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide (CID 107551218) is 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide.
What is the SMILES notation for 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide?
The canonical SMILES for 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide is [H]/N=C(\N)c1ccnc(OCCC(F)(F)F)n1.
What is the InChIKey of 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide?
The InChIKey is WRQBZNCWNGQDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N4O/c9-8(10,11)2-4-16-7-14-3-1-5(15-7)6(12)13/h1,3H,2,4H2,(H3,12,13).
What are the key properties of 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide?
2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide has a molecular weight of 234.18 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,3-trifluoropropoxy)pyrimidine-4-carboximidamide is sourced from PubChem (CID 107551218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).